C11H11N3OS — CID 168709953
1-(3H-benzimidazol-5-yl)-4-sulfanylpyrrolidin-2-one (PubChem CID 168709953) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-(3H-benzimidazol-5-yl)-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168709953 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-4-sulfanylpyrrolidin-2-one |
| SMILES | O=C1CC(S)CN1c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C11H11N3OS/c15-11-4-8(16)5-14(11)7-1-2-9-10(3-7)13-6-12-9/h1-3,6,8,16H,4-5H2,(H,12,13) |
| InChIKey | WYFSSWZLHHEALY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|