C12H12N2O2S — CID 168709157
1-(2-methyl-1,3-benzoxazol-6-yl)-4-sulfanylpyrrolidin-2-one (PubChem CID 168709157) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 1-(2-methyl-1,3-benzoxazol-6-yl)-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-(2-methyl-1,3-benzoxazol-6-yl)-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168709157 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 1-(2-methyl-1,3-benzoxazol-6-yl)-4-sulfanylpyrrolidin-2-one |
| SMILES | Cc1nc2ccc(N3CC(S)CC3=O)cc2o1 |
| InChI | InChI=1S/C12H12N2O2S/c1-7-13-10-3-2-8(4-11(10)16-7)14-6-9(17)5-12(14)15/h2-4,9,17H,5-6H2,1H3 |
| InChIKey | YEOVQXBFPWKGFD-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|