C12H12N4O4S — CID 168718778
5-oxo-1-(4-oxo-3H-quinazolin-6-yl)pyrrolidine-3-sulfonamide (PubChem CID 168718778) has the molecular formula C12H12N4O4S and a molecular weight of 308.32 g/mol. Its IUPAC name is 5-oxo-1-(4-oxo-3H-quinazolin-6-yl)pyrrolidine-3-sulfonamide.
| Compound Name | 5-oxo-1-(4-oxo-3H-quinazolin-6-yl)pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168718778 |
| Molecular Formula | C12H12N4O4S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 5-oxo-1-(4-oxo-3H-quinazolin-6-yl)pyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2ccc3nc[nH]c(=O)c3c2)C1 |
| InChI | InChI=1S/C12H12N4O4S/c13-21(19,20)8-4-11(17)16(5-8)7-1-2-10-9(3-7)12(18)15-6-14-10/h1-3,6,8H,4-5H2,(H2,13,19,20)(H,14,15,18) |
| InChIKey | CMYSIBBBNCHTGB-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |