C13H12FN3O4S — CID 168677047
[5-oxo-1-(4-oxo-3H-quinazolin-6-yl)pyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168677047) has the molecular formula C13H12FN3O4S and a molecular weight of 325.32 g/mol. Its IUPAC name is [5-oxo-1-(4-oxo-3H-quinazolin-6-yl)pyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [5-oxo-1-(4-oxo-3H-quinazolin-6-yl)pyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168677047 |
| Molecular Formula | C13H12FN3O4S |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | [5-oxo-1-(4-oxo-3H-quinazolin-6-yl)pyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | O=C1CC(CS(=O)(=O)F)CN1c1ccc2nc[nH]c(=O)c2c1 |
| InChI | InChI=1S/C13H12FN3O4S/c14-22(20,21)6-8-3-12(18)17(5-8)9-1-2-11-10(4-9)13(19)16-7-15-11/h1-2,4,7-8H,3,5-6H2,(H,15,16,19) |
| InChIKey | BUBRNTNAUFLZOS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |