C13H12F3NO2 — CID 168686502
4-ethenyl-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one (PubChem CID 168686502) has the molecular formula C13H12F3NO2 and a molecular weight of 271.24 g/mol. Its IUPAC name is 4-ethenyl-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one.
| Compound Name | 4-ethenyl-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168686502 |
| Molecular Formula | C13H12F3NO2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-ethenyl-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2cccc(OC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C13H12F3NO2/c1-2-9-6-12(18)17(8-9)10-4-3-5-11(7-10)19-13(14,15)16/h2-5,7,9H,1,6,8H2 |
| InChIKey | ISGVEXMDTPOYHV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|