C8H5F2IN4O2 — CID 137132172
4-[3-[difluoro(iodo)methoxy]phenyl]-1H-tetrazol-5-one (PubChem CID 137132172) has the molecular formula C8H5F2IN4O2 and a molecular weight of 354.05 g/mol. Its IUPAC name is 4-[3-[difluoro(iodo)methoxy]phenyl]-1H-tetrazol-5-one.
| Compound Name | 4-[3-[difluoro(iodo)methoxy]phenyl]-1H-tetrazol-5-one |
|---|---|
| PubChem CID | 137132172 |
| Molecular Formula | C8H5F2IN4O2 |
| Molecular Weight | 354.05 g/mol |
| Exact Mass | 353.94 |
| IUPAC Name | 4-[3-[difluoro(iodo)methoxy]phenyl]-1H-tetrazol-5-one |
| SMILES | O=c1[nH]nnn1-c1cccc(OC(F)(F)I)c1 |
| InChI | InChI=1S/C8H5F2IN4O2/c9-8(10,11)17-6-3-1-2-5(4-6)15-7(16)12-13-14-15/h1-4H,(H,12,14,16) |
| InChIKey | JWQHOKVEADPXRJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.05 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|