C28H36Cl2N4 — CID 143690198
4,5-dichloro-1-[2,4-dimethyl-6-[2-(1,3,5-trimethyl-2H-imidazol-4-yl)ethyl]phenyl]-3-(2,4,6-trimethylphenyl)-2H-imidazole (PubChem CID 143690198) has the molecular formula C28H36Cl2N4 and a molecular weight of 499.53 g/mol. Its IUPAC name is 4,5-dichloro-1-[2,4-dimethyl-6-[2-(1,3,5-trimethyl-2H-imidazol-4-yl)ethyl]phenyl]-3-(2,4,6-trimethylphenyl)-2H-imidazole.
| Compound Name | 4,5-dichloro-1-[2,4-dimethyl-6-[2-(1,3,5-trimethyl-2H-imidazol-4-yl)ethyl]phenyl]-3-(2,4,6-trimethylphenyl)-2H-imidazole |
|---|---|
| PubChem CID | 143690198 |
| Molecular Formula | C28H36Cl2N4 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 4,5-dichloro-1-[2,4-dimethyl-6-[2-(1,3,5-trimethyl-2H-imidazol-4-yl)ethyl]phenyl]-3-(2,4,6-trimethylphenyl)-2H-imidazole |
| SMILES | CC1=C(CCc2cc(C)cc(C)c2N2CN(c3c(C)cc(C)cc3C)C(Cl)=C2Cl)N(C)CN1C |
| InChI | InChI=1S/C28H36Cl2N4/c1-17-11-19(3)25(20(4)12-17)33-16-34(28(30)27(33)29)26-21(5)13-18(2)14-23(26)9-10-24-22(6)31(7)15-32(24)8/h11-14H,9-10,15-16H2,1-8H3 |
| InChIKey | GXUDFNXGTUTEFW-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|