C18H34N2 — CID 143229850
ethane;3-(2,4,6-trimethylphenyl)-1,2-dihydroimidazole (PubChem CID 143229850) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is ethane;3-(2,4,6-trimethylphenyl)-1,2-dihydroimidazole.
| Compound Name | ethane;3-(2,4,6-trimethylphenyl)-1,2-dihydroimidazole |
|---|---|
| PubChem CID | 143229850 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | ethane;3-(2,4,6-trimethylphenyl)-1,2-dihydroimidazole |
| SMILES | CC.CC.CC.Cc1cc(C)c(N2C=CNC2)c(C)c1 |
| InChI | InChI=1S/C12H16N2.3C2H6/c1-9-6-10(2)12(11(3)7-9)14-5-4-13-8-14;3*1-2/h4-7,13H,8H2,1-3H3;3*1-2H3 |
| InChIKey | QTAAZQCZKTWYBS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |