C20H26N2S — CID 123168199
1-(2,4,6-trimethylphenyl)-3-(1,3,5-trimethylthiopyran-2-yl)-2H-imidazole (PubChem CID 123168199) has the molecular formula C20H26N2S and a molecular weight of 326.51 g/mol. Its IUPAC name is 1-(2,4,6-trimethylphenyl)-3-(1,3,5-trimethylthiopyran-2-yl)-2H-imidazole.
| Compound Name | 1-(2,4,6-trimethylphenyl)-3-(1,3,5-trimethylthiopyran-2-yl)-2H-imidazole |
|---|---|
| PubChem CID | 123168199 |
| Molecular Formula | C20H26N2S |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 1-(2,4,6-trimethylphenyl)-3-(1,3,5-trimethylthiopyran-2-yl)-2H-imidazole |
| SMILES | CC1=CC(C)=C(N2C=CN(c3c(C)cc(C)cc3C)C2)S(C)=C1 |
| InChI | InChI=1S/C20H26N2S/c1-14-9-16(3)19(17(4)10-14)21-7-8-22(13-21)20-18(5)11-15(2)12-23(20)6/h7-12H,13H2,1-6H3 |
| InChIKey | AGVKREZNLGOYHZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|