C22H32N2 — CID 155632461
1-[(1R,2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-3-(2,4,6-trimethylphenyl)-2H-imidazole (PubChem CID 155632461) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-[(1R,2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-3-(2,4,6-trimethylphenyl)-2H-imidazole.
| Compound Name | 1-[(1R,2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-3-(2,4,6-trimethylphenyl)-2H-imidazole |
|---|---|
| PubChem CID | 155632461 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 1-[(1R,2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-3-(2,4,6-trimethylphenyl)-2H-imidazole |
| SMILES | Cc1cc(C)c(N2C=CN(C3C[C@@H]4C[C@H]([C@H]3C)C4(C)C)C2)c(C)c1 |
| InChI | InChI=1S/C22H32N2/c1-14-9-15(2)21(16(3)10-14)24-8-7-23(13-24)20-12-18-11-19(17(20)4)22(18,5)6/h7-10,17-20H,11-13H2,1-6H3/t17-,18+,19-,20?/m1/s1 |
| InChIKey | JMMSCWXFGCMGSL-BMHONFFRSA-N |
| XLogP | 5.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |