About CID 134966229
CID 134966229 (PubChem CID 134966229) has the molecular formula C13H17N3
and a molecular weight of 215.30 g/mol.
Molecular Properties
| Compound Name | CID 134966229 |
| PubChem CID | 134966229 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | — |
| SMILES | CC1=NN(c2c(C)cc(C)cc2C)[C]N1C |
| InChI | InChI=1S/C13H17N3/c1-9-6-10(2)13(11(3)7-9)16-8-15(5)12(4)14-16/h6-7H,1-5H3 |
| InChIKey | OAYLIVMGQOFUDZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 134966229 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134966229?
The IUPAC name of CID 134966229 (CID 134966229) is not available.
What is the SMILES notation for CID 134966229?
The canonical SMILES for CID 134966229 is CC1=NN(c2c(C)cc(C)cc2C)[C]N1C.
What is the InChIKey of CID 134966229?
The InChIKey is OAYLIVMGQOFUDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3/c1-9-6-10(2)13(11(3)7-9)16-8-15(5)12(4)14-16/h6-7H,1-5H3.
What are the key properties of CID 134966229?
CID 134966229 has a molecular weight of 215.30 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134966229 is sourced from PubChem (CID 134966229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).