C44H66Cl2N3OPRu — CID 140713470
1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide;dichloro-[(2-oxopyrrolidin-1-yl)methylidene]ruthenium;tricyclohexylphosphanium (PubChem CID 140713470) has the molecular formula C44H66Cl2N3OPRu and a molecular weight of 855.98 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide;dichloro-[(2-oxopyrrolidin-1-yl)methylidene]ruthenium;tricyclohexylphosphanium.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide;dichloro-[(2-oxopyrrolidin-1-yl)methylidene]ruthenium;tricyclohexylphosphanium |
|---|---|
| PubChem CID | 140713470 |
| Molecular Formula | C44H66Cl2N3OPRu |
| Molecular Weight | 855.98 g/mol |
| Exact Mass | 855.34 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide;dichloro-[(2-oxopyrrolidin-1-yl)methylidene]ruthenium;tricyclohexylphosphanium |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.Cc1cc(C)c(N2C=CN(c3c(C)cc(C)cc3C)[CH-]2)c(C)c1.O=C1CCCN1C=[Ru](Cl)Cl |
| InChI | InChI=1S/C21H25N2.C18H33P.C5H7NO.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-6-4-2-3-5(6)7;;;/h7-13H,1-6H3;16-18H,1-15H2;1H,2-4H2;2*1H;/q-1;;;;;+2/p-1 |
| InChIKey | MLZMONNABTYNLP-UHFFFAOYSA-M |
| XLogP | 12.95 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.98 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|