C37H62Cl2NPRu — CID 59566371
dichloro(hex-1-enylidene)ruthenium;tricyclohexylphosphanium;1-(2,4,6-trimethylphenyl)pyrrolidin-5-ide (PubChem CID 59566371) has the molecular formula C37H62Cl2NPRu and a molecular weight of 723.86 g/mol. Its IUPAC name is dichloro(hex-1-enylidene)ruthenium;tricyclohexylphosphanium;1-(2,4,6-trimethylphenyl)pyrrolidin-5-ide.
| Compound Name | dichloro(hex-1-enylidene)ruthenium;tricyclohexylphosphanium;1-(2,4,6-trimethylphenyl)pyrrolidin-5-ide |
|---|---|
| PubChem CID | 59566371 |
| Molecular Formula | C37H62Cl2NPRu |
| Molecular Weight | 723.86 g/mol |
| Exact Mass | 723.30 |
| IUPAC Name | dichloro(hex-1-enylidene)ruthenium;tricyclohexylphosphanium;1-(2,4,6-trimethylphenyl)pyrrolidin-5-ide |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.CCCCC=C=[Ru](Cl)Cl.Cc1cc(C)c(N2[CH-]CCC2)c(C)c1 |
| InChI | InChI=1S/C18H33P.C13H18N.C6H10.2ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-10-8-11(2)13(12(3)9-10)14-6-4-5-7-14;1-3-5-6-4-2;;;/h16-18H,1-15H2;6,8-9H,4-5,7H2,1-3H3;4H,3,5-6H2,1H3;2*1H;/q;-1;;;;+2/p-1 |
| InChIKey | DVVYCPNGGIMPQK-UHFFFAOYSA-M |
| XLogP | 12.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.86 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|