C41H78Cl2P2Ru+2 — CID 23531107
dichloro(pentylidene)ruthenium;bis(tricyclohexylphosphanium) (PubChem CID 23531107) has the molecular formula C41H78Cl2P2Ru+2 and a molecular weight of 805.00 g/mol. Its IUPAC name is dichloro(pentylidene)ruthenium;bis(tricyclohexylphosphanium).
| Compound Name | dichloro(pentylidene)ruthenium;bis(tricyclohexylphosphanium) |
|---|---|
| PubChem CID | 23531107 |
| Molecular Formula | C41H78Cl2P2Ru+2 |
| Molecular Weight | 805.00 g/mol |
| Exact Mass | 804.40 |
| IUPAC Name | dichloro(pentylidene)ruthenium;bis(tricyclohexylphosphanium) |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.CCCCC=[Ru](Cl)Cl |
| InChI | InChI=1S/2C18H33P.C5H10.2ClH.Ru/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-5-4-2;;;/h2*16-18H,1-15H2;1H,3-5H2,2H3;2*1H;/q;;;;;+2 |
| InChIKey | MDTHVZOBLYJOAQ-UHFFFAOYSA-N |
| XLogP | 15.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.00 |
| LogP ≤ 5 | 15.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|