About ruthenium;tricyclohexylphosphanium
ruthenium;tricyclohexylphosphanium (PubChem CID 76540697) has the molecular formula C18H34PRu+
and a molecular weight of 382.51 g/mol. Its IUPAC name is ruthenium;tricyclohexylphosphanium.
Molecular Properties
| Compound Name | ruthenium;tricyclohexylphosphanium |
| PubChem CID | 76540697 |
| Molecular Formula | C18H34PRu+ |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | ruthenium;tricyclohexylphosphanium |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.[Ru] |
| InChI | InChI=1S/C18H33P.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h16-18H,1-15H2;/p+1 |
| InChIKey | GHPHCACQRYSXSS-UHFFFAOYSA-O |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ruthenium;tricyclohexylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ruthenium;tricyclohexylphosphanium?
The IUPAC name of ruthenium;tricyclohexylphosphanium (CID 76540697) is ruthenium;tricyclohexylphosphanium.
What is the SMILES notation for ruthenium;tricyclohexylphosphanium?
The canonical SMILES for ruthenium;tricyclohexylphosphanium is C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.[Ru].
What is the InChIKey of ruthenium;tricyclohexylphosphanium?
The InChIKey is GHPHCACQRYSXSS-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H33P.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h16-18H,1-15H2;/p+1.
What are the key properties of ruthenium;tricyclohexylphosphanium?
ruthenium;tricyclohexylphosphanium has a molecular weight of 382.51 g/mol, XLogP of 6.20, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ruthenium;tricyclohexylphosphanium is sourced from PubChem (CID 76540697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).