About palladium;prop-1-ene;tricyclopentylphosphanium
palladium;prop-1-ene;tricyclopentylphosphanium (PubChem CID 87962886) has the molecular formula C18H33PPd
and a molecular weight of 386.86 g/mol. Its IUPAC name is palladium;prop-1-ene;tricyclopentylphosphanium.
Molecular Properties
| Compound Name | palladium;prop-1-ene;tricyclopentylphosphanium |
| PubChem CID | 87962886 |
| Molecular Formula | C18H33PPd |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | palladium;prop-1-ene;tricyclopentylphosphanium |
| SMILES | C1CCC([PH+](C2CCCC2)C2CCCC2)C1.C=C[CH2-].[Pd] |
| InChI | InChI=1S/C15H27P.C3H5.Pd/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15;1-3-2;/h13-15H,1-12H2;3H,1-2H2;/q;-1;/p+1 |
| InChIKey | YSWPDTPLKYRHST-UHFFFAOYSA-O |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze palladium;prop-1-ene;tricyclopentylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium;prop-1-ene;tricyclopentylphosphanium?
The IUPAC name of palladium;prop-1-ene;tricyclopentylphosphanium (CID 87962886) is palladium;prop-1-ene;tricyclopentylphosphanium.
What is the SMILES notation for palladium;prop-1-ene;tricyclopentylphosphanium?
The canonical SMILES for palladium;prop-1-ene;tricyclopentylphosphanium is C1CCC([PH+](C2CCCC2)C2CCCC2)C1.C=C[CH2-].[Pd].
What is the InChIKey of palladium;prop-1-ene;tricyclopentylphosphanium?
The InChIKey is YSWPDTPLKYRHST-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H27P.C3H5.Pd/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15;1-3-2;/h13-15H,1-12H2;3H,1-2H2;/q;-1;/p+1.
What are the key properties of palladium;prop-1-ene;tricyclopentylphosphanium?
palladium;prop-1-ene;tricyclopentylphosphanium has a molecular weight of 386.86 g/mol, XLogP of 6.03, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;prop-1-ene;tricyclopentylphosphanium is sourced from PubChem (CID 87962886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).