About dichloro(methylidene)ruthenium;bis(tricyclohexylphosphanium)
dichloro(methylidene)ruthenium;bis(tricyclohexylphosphanium) (PubChem CID 23520456) has the molecular formula C37H70Cl2P2Ru+2
and a molecular weight of 748.89 g/mol. Its IUPAC name is dichloro(methylidene)ruthenium;bis(tricyclohexylphosphanium).
Molecular Properties
| Compound Name | dichloro(methylidene)ruthenium;bis(tricyclohexylphosphanium) |
| PubChem CID | 23520456 |
| Molecular Formula | C37H70Cl2P2Ru+2 |
| Molecular Weight | 748.89 g/mol |
| Exact Mass | 748.34 |
| IUPAC Name | dichloro(methylidene)ruthenium;bis(tricyclohexylphosphanium) |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.C=[Ru](Cl)Cl |
| InChI | InChI=1S/2C18H33P.CH2.2ClH.Ru/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;/h2*16-18H,1-15H2;1H2;2*1H;/q;;;;;+2 |
| InChIKey | JPBPDPAGGRDXNP-UHFFFAOYSA-N |
| XLogP | 13.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 748.89 |
| LogP ≤ 5 | 13.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloro(methylidene)ruthenium;bis(tricyclohexylphosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(methylidene)ruthenium;bis(tricyclohexylphosphanium)?
The IUPAC name of dichloro(methylidene)ruthenium;bis(tricyclohexylphosphanium) (CID 23520456) is dichloro(methylidene)ruthenium;bis(tricyclohexylphosphanium).
What is the SMILES notation for dichloro(methylidene)ruthenium;bis(tricyclohexylphosphanium)?
The canonical SMILES for dichloro(methylidene)ruthenium;bis(tricyclohexylphosphanium) is C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.C=[Ru](Cl)Cl.
What is the InChIKey of dichloro(methylidene)ruthenium;bis(tricyclohexylphosphanium)?
The InChIKey is JPBPDPAGGRDXNP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H33P.CH2.2ClH.Ru/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;/h2*16-18H,1-15H2;1H2;2*1H;/q;;;;;+2.
What are the key properties of dichloro(methylidene)ruthenium;bis(tricyclohexylphosphanium)?
dichloro(methylidene)ruthenium;bis(tricyclohexylphosphanium) has a molecular weight of 748.89 g/mol, XLogP of 13.74, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(methylidene)ruthenium;bis(tricyclohexylphosphanium) is sourced from PubChem (CID 23520456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).