C26H43Cl2PRu — CID 22899065
benzylidene(dichloro)ruthenium;carbanide;tricyclohexylphosphanium (PubChem CID 22899065) has the molecular formula C26H43Cl2PRu and a molecular weight of 558.58 g/mol. Its IUPAC name is benzylidene(dichloro)ruthenium;carbanide;tricyclohexylphosphanium.
| Compound Name | benzylidene(dichloro)ruthenium;carbanide;tricyclohexylphosphanium |
|---|---|
| PubChem CID | 22899065 |
| Molecular Formula | C26H43Cl2PRu |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | benzylidene(dichloro)ruthenium;carbanide;tricyclohexylphosphanium |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.Cl[Ru](Cl)=Cc1ccccc1.[CH3-] |
| InChI | InChI=1S/C18H33P.C7H6.CH3.2ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-5-3-2-4-6-7;;;;/h16-18H,1-15H2;1-6H;1H3;2*1H;/q;;-1;;;+2/p-1 |
| InChIKey | REKFQVNJGOAETJ-UHFFFAOYSA-M |
| XLogP | 9.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|