C34H51Cl2NPRu+ — CID 162458941
[2-[[benzyl(methyl)amino]methyl]phenyl]methylidene-dichlororuthenium;tricyclohexylphosphanium (PubChem CID 162458941) has the molecular formula C34H51Cl2NPRu+ and a molecular weight of 676.74 g/mol. Its IUPAC name is [2-[[benzyl(methyl)amino]methyl]phenyl]methylidene-dichlororuthenium;tricyclohexylphosphanium.
| Compound Name | [2-[[benzyl(methyl)amino]methyl]phenyl]methylidene-dichlororuthenium;tricyclohexylphosphanium |
|---|---|
| PubChem CID | 162458941 |
| Molecular Formula | C34H51Cl2NPRu+ |
| Molecular Weight | 676.74 g/mol |
| Exact Mass | 676.22 |
| IUPAC Name | [2-[[benzyl(methyl)amino]methyl]phenyl]methylidene-dichlororuthenium;tricyclohexylphosphanium |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.CN(Cc1ccccc1)Cc1ccccc1C=[Ru](Cl)Cl |
| InChI | InChI=1S/C18H33P.C16H17N.2ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-14-8-6-7-11-16(14)13-17(2)12-15-9-4-3-5-10-15;;;/h16-18H,1-15H2;1,3-11H,12-13H2,2H3;2*1H;/q;;;;+2/p-1 |
| InChIKey | RLPZDZXGHIDKRZ-UHFFFAOYSA-M |
| XLogP | 10.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.74 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|