C16H17ClCuN2 — CID 135084953
chlorocopper(1+);2-(2,4,6-trimethylphenyl)-3H-imidazo[1,5-a]pyridin-3-ide (PubChem CID 135084953) has the molecular formula C16H17ClCuN2 and a molecular weight of 336.33 g/mol. Its IUPAC name is chlorocopper(1+);2-(2,4,6-trimethylphenyl)-3H-imidazo[1,5-a]pyridin-3-ide.
| Compound Name | chlorocopper(1+);2-(2,4,6-trimethylphenyl)-3H-imidazo[1,5-a]pyridin-3-ide |
|---|---|
| PubChem CID | 135084953 |
| Molecular Formula | C16H17ClCuN2 |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | chlorocopper(1+);2-(2,4,6-trimethylphenyl)-3H-imidazo[1,5-a]pyridin-3-ide |
| SMILES | Cc1cc(C)c(N2C=C3C=CC=CN3[CH-]2)c(C)c1.Cl[Cu+] |
| InChI | InChI=1S/C16H17N2.ClH.Cu/c1-12-8-13(2)16(14(3)9-12)18-10-15-6-4-5-7-17(15)11-18;;/h4-11H,1-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | WSQIXIGRBDHDTD-UHFFFAOYSA-M |
| XLogP | 4.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|