C22H24AuClN3- — CID 172516514
chlorogold;N,N-dimethyl-2-(2,4,6-trimethylphenyl)-1H-imidazo[1,5-a]quinolin-1-id-9-amine (PubChem CID 172516514) has the molecular formula C22H24AuClN3- and a molecular weight of 562.88 g/mol. Its IUPAC name is chlorogold;N,N-dimethyl-2-(2,4,6-trimethylphenyl)-1H-imidazo[1,5-a]quinolin-1-id-9-amine.
| Compound Name | chlorogold;N,N-dimethyl-2-(2,4,6-trimethylphenyl)-1H-imidazo[1,5-a]quinolin-1-id-9-amine |
|---|---|
| PubChem CID | 172516514 |
| Molecular Formula | C22H24AuClN3- |
| Molecular Weight | 562.88 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | chlorogold;N,N-dimethyl-2-(2,4,6-trimethylphenyl)-1H-imidazo[1,5-a]quinolin-1-id-9-amine |
| SMILES | Cc1cc(C)c(N2C=C3C=Cc4cccc(N(C)C)c4N3[CH-]2)c(C)c1.Cl[Au] |
| InChI | InChI=1S/C22H24N3.Au.ClH/c1-15-11-16(2)21(17(3)12-15)24-13-19-10-9-18-7-6-8-20(23(4)5)22(18)25(19)14-24;;/h6-14H,1-5H3;;1H/q-1;+1;/p-1 |
| InChIKey | FFRZMABRURGDKR-UHFFFAOYSA-M |
| XLogP | 5.68 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.88 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|