C49H43AuClN2- — CID 174057934
2-(2,6-dibenzhydryl-4-methylphenyl)-5-(2,4,6-trimethylphenyl)-3H-imidazo[1,5-a]pyridin-3-ide;gold(1+);chloride (PubChem CID 174057934) has the molecular formula C49H43AuClN2- and a molecular weight of 892.32 g/mol. Its IUPAC name is 2-(2,6-dibenzhydryl-4-methylphenyl)-5-(2,4,6-trimethylphenyl)-3H-imidazo[1,5-a]pyridin-3-ide;gold(1+);chloride.
| Compound Name | 2-(2,6-dibenzhydryl-4-methylphenyl)-5-(2,4,6-trimethylphenyl)-3H-imidazo[1,5-a]pyridin-3-ide;gold(1+);chloride |
|---|---|
| PubChem CID | 174057934 |
| Molecular Formula | C49H43AuClN2- |
| Molecular Weight | 892.32 g/mol |
| Exact Mass | 891.28 |
| IUPAC Name | 2-(2,6-dibenzhydryl-4-methylphenyl)-5-(2,4,6-trimethylphenyl)-3H-imidazo[1,5-a]pyridin-3-ide;gold(1+);chloride |
| SMILES | Cc1cc(C)c(C2=CC=CC3=CN(c4c(C(c5ccccc5)c5ccccc5)cc(C)cc4C(c4ccccc4)c4ccccc4)[CH-]N32)c(C)c1.[Au+].[Cl-] |
| InChI | InChI=1S/C49H43N2.Au.ClH/c1-34-28-36(3)46(37(4)29-34)45-27-17-26-42-32-50(33-51(42)45)49-43(47(38-18-9-5-10-19-38)39-20-11-6-12-21-39)30-35(2)31-44(49)48(40-22-13-7-14-23-40)41-24-15-8-16-25-41;;/h5-33,47-48H,1-4H3;;1H/q-1;+1;/p-1 |
| InChIKey | ZVPOAMREQVTGPX-UHFFFAOYSA-M |
| XLogP | 8.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.32 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|