C12H20N2 — CID 21122485
1-N,1-N,2-N,2-N,3,5-hexamethylbenzene-1,2-diamine (PubChem CID 21122485) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-N,1-N,2-N,2-N,3,5-hexamethylbenzene-1,2-diamine.
| Compound Name | 1-N,1-N,2-N,2-N,3,5-hexamethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 21122485 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-N,1-N,2-N,2-N,3,5-hexamethylbenzene-1,2-diamine |
| SMILES | Cc1cc(C)c(N(C)C)c(N(C)C)c1 |
| InChI | InChI=1S/C12H20N2/c1-9-7-10(2)12(14(5)6)11(8-9)13(3)4/h7-8H,1-6H3 |
| InChIKey | PYKVYGPLNKGUBA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |