C11H15NO3 — CID 115170741
(2-methoxy-3,5-dimethylphenyl)-methylcarbamic acid (PubChem CID 115170741) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is (2-methoxy-3,5-dimethylphenyl)-methylcarbamic acid.
| Compound Name | (2-methoxy-3,5-dimethylphenyl)-methylcarbamic acid |
|---|---|
| PubChem CID | 115170741 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (2-methoxy-3,5-dimethylphenyl)-methylcarbamic acid |
| SMILES | COc1c(C)cc(C)cc1N(C)C(=O)O |
| InChI | InChI=1S/C11H15NO3/c1-7-5-8(2)10(15-4)9(6-7)12(3)11(13)14/h5-6H,1-4H3,(H,13,14) |
| InChIKey | PDEMUFOVEQBGSO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |