C14H22N2O3 — CID 115241124
2-amino-4-(2-methoxy-N,3,5-trimethylanilino)butanoic acid (PubChem CID 115241124) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-amino-4-(2-methoxy-N,3,5-trimethylanilino)butanoic acid.
| Compound Name | 2-amino-4-(2-methoxy-N,3,5-trimethylanilino)butanoic acid |
|---|---|
| PubChem CID | 115241124 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-amino-4-(2-methoxy-N,3,5-trimethylanilino)butanoic acid |
| SMILES | COc1c(C)cc(C)cc1N(C)CCC(N)C(=O)O |
| InChI | InChI=1S/C14H22N2O3/c1-9-7-10(2)13(19-4)12(8-9)16(3)6-5-11(15)14(17)18/h7-8,11H,5-6,15H2,1-4H3,(H,17,18) |
| InChIKey | SGXHSAPOFIJKIV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |