C9H12FN — CID 118521335
2-fluoro-N,N,5-trimethylaniline (PubChem CID 118521335) has the molecular formula C9H12FN and a molecular weight of 153.20 g/mol. Its IUPAC name is 2-fluoro-N,N,5-trimethylaniline.
| Compound Name | 2-fluoro-N,N,5-trimethylaniline |
|---|---|
| PubChem CID | 118521335 |
| Molecular Formula | C9H12FN |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 2-fluoro-N,N,5-trimethylaniline |
| SMILES | Cc1ccc(F)c(N(C)C)c1 |
| InChI | InChI=1S/C9H12FN/c1-7-4-5-8(10)9(6-7)11(2)3/h4-6H,1-3H3 |
| InChIKey | IOMQOLCJZRCQMG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |