C9H12FNS2 — CID 175447106
2-fluoro-4-methyl-N,N-bis(methylsulfanyl)aniline (PubChem CID 175447106) has the molecular formula C9H12FNS2 and a molecular weight of 217.33 g/mol. Its IUPAC name is 2-fluoro-4-methyl-N,N-bis(methylsulfanyl)aniline.
| Compound Name | 2-fluoro-4-methyl-N,N-bis(methylsulfanyl)aniline |
|---|---|
| PubChem CID | 175447106 |
| Molecular Formula | C9H12FNS2 |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 2-fluoro-4-methyl-N,N-bis(methylsulfanyl)aniline |
| SMILES | CSN(SC)c1ccc(C)cc1F |
| InChI | InChI=1S/C9H12FNS2/c1-7-4-5-9(8(10)6-7)11(12-2)13-3/h4-6H,1-3H3 |
| InChIKey | JAJRUNVOLZTNBX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|