C14H9F6N — CID 118835632
2-fluoro-N,N-dimethyl-5-(2,3,4,5,6-pentafluorophenyl)aniline (PubChem CID 118835632) has the molecular formula C14H9F6N and a molecular weight of 305.22 g/mol. Its IUPAC name is 2-fluoro-N,N-dimethyl-5-(2,3,4,5,6-pentafluorophenyl)aniline.
| Compound Name | 2-fluoro-N,N-dimethyl-5-(2,3,4,5,6-pentafluorophenyl)aniline |
|---|---|
| PubChem CID | 118835632 |
| Molecular Formula | C14H9F6N |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-fluoro-N,N-dimethyl-5-(2,3,4,5,6-pentafluorophenyl)aniline |
| SMILES | CN(C)c1cc(-c2c(F)c(F)c(F)c(F)c2F)ccc1F |
| InChI | InChI=1S/C14H9F6N/c1-21(2)8-5-6(3-4-7(8)15)9-10(16)12(18)14(20)13(19)11(9)17/h3-5H,1-2H3 |
| InChIKey | QOCUJZNMHCWOMT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|