C14H12F3N — CID 134631671
5-(2,3-difluorophenyl)-2-fluoro-N,N-dimethylaniline (PubChem CID 134631671) has the molecular formula C14H12F3N and a molecular weight of 251.25 g/mol. Its IUPAC name is 5-(2,3-difluorophenyl)-2-fluoro-N,N-dimethylaniline.
| Compound Name | 5-(2,3-difluorophenyl)-2-fluoro-N,N-dimethylaniline |
|---|---|
| PubChem CID | 134631671 |
| Molecular Formula | C14H12F3N |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 5-(2,3-difluorophenyl)-2-fluoro-N,N-dimethylaniline |
| SMILES | CN(C)c1cc(-c2cccc(F)c2F)ccc1F |
| InChI | InChI=1S/C14H12F3N/c1-18(2)13-8-9(6-7-11(13)15)10-4-3-5-12(16)14(10)17/h3-8H,1-2H3 |
| InChIKey | QLRASDJDJNQAQC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |