C13H9ClF2 — CID 134625893
1-(3-chloro-4-methylphenyl)-2,3-difluorobenzene (PubChem CID 134625893) has the molecular formula C13H9ClF2 and a molecular weight of 238.66 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-2,3-difluorobenzene.
| Compound Name | 1-(3-chloro-4-methylphenyl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 134625893 |
| Molecular Formula | C13H9ClF2 |
| Molecular Weight | 238.66 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-2,3-difluorobenzene |
| SMILES | Cc1ccc(-c2cccc(F)c2F)cc1Cl |
| InChI | InChI=1S/C13H9ClF2/c1-8-5-6-9(7-11(8)14)10-3-2-4-12(15)13(10)16/h2-7H,1H3 |
| InChIKey | YPDFKUDXZJPFQH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.66 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |