About 2-fluoro-N,N-dimethyl-5-(2-methyl-1,3-oxazol-5-yl)aniline
2-fluoro-N,N-dimethyl-5-(2-methyl-1,3-oxazol-5-yl)aniline (PubChem CID 141279145) has the molecular formula C12H13FN2O
and a molecular weight of 220.25 g/mol. Its IUPAC name is 2-fluoro-N,N-dimethyl-5-(2-methyl-1,3-oxazol-5-yl)aniline.
Molecular Properties
| Compound Name | 2-fluoro-N,N-dimethyl-5-(2-methyl-1,3-oxazol-5-yl)aniline |
| PubChem CID | 141279145 |
| Molecular Formula | C12H13FN2O |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-fluoro-N,N-dimethyl-5-(2-methyl-1,3-oxazol-5-yl)aniline |
| SMILES | Cc1ncc(-c2ccc(F)c(N(C)C)c2)o1 |
| InChI | InChI=1S/C12H13FN2O/c1-8-14-7-12(16-8)9-4-5-10(13)11(6-9)15(2)3/h4-7H,1-3H3 |
| InChIKey | YNNPEFOILYJQFD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-N,N-dimethyl-5-(2-methyl-1,3-oxazol-5-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N,N-dimethyl-5-(2-methyl-1,3-oxazol-5-yl)aniline?
The IUPAC name of 2-fluoro-N,N-dimethyl-5-(2-methyl-1,3-oxazol-5-yl)aniline (CID 141279145) is 2-fluoro-N,N-dimethyl-5-(2-methyl-1,3-oxazol-5-yl)aniline.
What is the SMILES notation for 2-fluoro-N,N-dimethyl-5-(2-methyl-1,3-oxazol-5-yl)aniline?
The canonical SMILES for 2-fluoro-N,N-dimethyl-5-(2-methyl-1,3-oxazol-5-yl)aniline is Cc1ncc(-c2ccc(F)c(N(C)C)c2)o1.
What is the InChIKey of 2-fluoro-N,N-dimethyl-5-(2-methyl-1,3-oxazol-5-yl)aniline?
The InChIKey is YNNPEFOILYJQFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2O/c1-8-14-7-12(16-8)9-4-5-10(13)11(6-9)15(2)3/h4-7H,1-3H3.
What are the key properties of 2-fluoro-N,N-dimethyl-5-(2-methyl-1,3-oxazol-5-yl)aniline?
2-fluoro-N,N-dimethyl-5-(2-methyl-1,3-oxazol-5-yl)aniline has a molecular weight of 220.25 g/mol, XLogP of 2.86, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N,N-dimethyl-5-(2-methyl-1,3-oxazol-5-yl)aniline is sourced from PubChem (CID 141279145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).