C10H8FNO2 — CID 175700477
4-fluoro-3-(2-methyl-1,3-oxazol-5-yl)phenol (PubChem CID 175700477) has the molecular formula C10H8FNO2 and a molecular weight of 193.18 g/mol. Its IUPAC name is 4-fluoro-3-(2-methyl-1,3-oxazol-5-yl)phenol.
| Compound Name | 4-fluoro-3-(2-methyl-1,3-oxazol-5-yl)phenol |
|---|---|
| PubChem CID | 175700477 |
| Molecular Formula | C10H8FNO2 |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 4-fluoro-3-(2-methyl-1,3-oxazol-5-yl)phenol |
| SMILES | Cc1ncc(-c2cc(O)ccc2F)o1 |
| InChI | InChI=1S/C10H8FNO2/c1-6-12-5-10(14-6)8-4-7(13)2-3-9(8)11/h2-5,13H,1H3 |
| InChIKey | RRWSAVKZZBXOIZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |