C11H11ClN2O — CID 13332314
5-(4-chlorophenyl)-N,N-dimethyl-1,3-oxazol-2-amine (PubChem CID 13332314) has the molecular formula C11H11ClN2O and a molecular weight of 222.68 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N,N-dimethyl-1,3-oxazol-2-amine.
| Compound Name | 5-(4-chlorophenyl)-N,N-dimethyl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 13332314 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 5-(4-chlorophenyl)-N,N-dimethyl-1,3-oxazol-2-amine |
| SMILES | CN(C)c1ncc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C11H11ClN2O/c1-14(2)11-13-7-10(15-11)8-3-5-9(12)6-4-8/h3-7H,1-2H3 |
| InChIKey | QQPCXOCBKZHUPM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |