C10H10ClN3O — CID 1487943
5-(4-chlorophenyl)-N,N-dimethyl-1,3,4-oxadiazol-2-amine (PubChem CID 1487943) has the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N,N-dimethyl-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(4-chlorophenyl)-N,N-dimethyl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 1487943 |
| Molecular Formula | C10H10ClN3O |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 5-(4-chlorophenyl)-N,N-dimethyl-1,3,4-oxadiazol-2-amine |
| SMILES | CN(C)c1nnc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C10H10ClN3O/c1-14(2)10-13-12-9(15-10)7-3-5-8(11)6-4-7/h3-6H,1-2H3 |
| InChIKey | MYGKAVHQHCUMIZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |