C12H12ClFN4O2 — CID 166430932
2-chloro-N-[4-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]phenyl]-2-fluoroacetamide (PubChem CID 166430932) has the molecular formula C12H12ClFN4O2 and a molecular weight of 298.71 g/mol. Its IUPAC name is 2-chloro-N-[4-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]phenyl]-2-fluoroacetamide.
| Compound Name | 2-chloro-N-[4-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]phenyl]-2-fluoroacetamide |
|---|---|
| PubChem CID | 166430932 |
| Molecular Formula | C12H12ClFN4O2 |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-chloro-N-[4-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]phenyl]-2-fluoroacetamide |
| SMILES | CN(C)c1nnc(-c2ccc(NC(=O)C(F)Cl)cc2)o1 |
| InChI | InChI=1S/C12H12ClFN4O2/c1-18(2)12-17-16-11(20-12)7-3-5-8(6-4-7)15-10(19)9(13)14/h3-6,9H,1-2H3,(H,15,19) |
| InChIKey | MRVXCSDCFHEUMZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|