C18H13NO — CID 10199073
2-methyl-5-[4-(2-phenylethynyl)phenyl]-1,3-oxazole (PubChem CID 10199073) has the molecular formula C18H13NO and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-methyl-5-[4-(2-phenylethynyl)phenyl]-1,3-oxazole.
| Compound Name | 2-methyl-5-[4-(2-phenylethynyl)phenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 10199073 |
| Molecular Formula | C18H13NO |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-methyl-5-[4-(2-phenylethynyl)phenyl]-1,3-oxazole |
| SMILES | Cc1ncc(-c2ccc(C#Cc3ccccc3)cc2)o1 |
| InChI | InChI=1S/C18H13NO/c1-14-19-13-18(20-14)17-11-9-16(10-12-17)8-7-15-5-3-2-4-6-15/h2-6,9-13H,1H3 |
| InChIKey | GHIGLFYNBYGNNM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|