About chlorogold;[2-(dimethylamino)phenyl]-dimethylphosphanium
chlorogold;[2-(dimethylamino)phenyl]-dimethylphosphanium (PubChem CID 176723278) has the molecular formula C10H17AuClNP+
and a molecular weight of 414.65 g/mol. Its IUPAC name is chlorogold;[2-(dimethylamino)phenyl]-dimethylphosphanium.
Molecular Properties
| Compound Name | chlorogold;[2-(dimethylamino)phenyl]-dimethylphosphanium |
| PubChem CID | 176723278 |
| Molecular Formula | C10H17AuClNP+ |
| Molecular Weight | 414.65 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | chlorogold;[2-(dimethylamino)phenyl]-dimethylphosphanium |
| SMILES | CN(C)c1ccccc1[PH+](C)C.Cl[Au] |
| InChI | InChI=1S/C10H16NP.Au.ClH/c1-11(2)9-7-5-6-8-10(9)12(3)4;;/h5-8H,1-4H3;;1H/q;+1; |
| InChIKey | YZGBLXVRCQFHMN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.65 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chlorogold;[2-(dimethylamino)phenyl]-dimethylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorogold;[2-(dimethylamino)phenyl]-dimethylphosphanium?
The IUPAC name of chlorogold;[2-(dimethylamino)phenyl]-dimethylphosphanium (CID 176723278) is chlorogold;[2-(dimethylamino)phenyl]-dimethylphosphanium.
What is the SMILES notation for chlorogold;[2-(dimethylamino)phenyl]-dimethylphosphanium?
The canonical SMILES for chlorogold;[2-(dimethylamino)phenyl]-dimethylphosphanium is CN(C)c1ccccc1[PH+](C)C.Cl[Au].
What is the InChIKey of chlorogold;[2-(dimethylamino)phenyl]-dimethylphosphanium?
The InChIKey is YZGBLXVRCQFHMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16NP.Au.ClH/c1-11(2)9-7-5-6-8-10(9)12(3)4;;/h5-8H,1-4H3;;1H/q;+1;.
What are the key properties of chlorogold;[2-(dimethylamino)phenyl]-dimethylphosphanium?
chlorogold;[2-(dimethylamino)phenyl]-dimethylphosphanium has a molecular weight of 414.65 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chlorogold;[2-(dimethylamino)phenyl]-dimethylphosphanium is sourced from PubChem (CID 176723278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).