About 2-(cyclopropylmethyl)-N,N-dimethylaniline
2-(cyclopropylmethyl)-N,N-dimethylaniline (PubChem CID 90792914) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 2-(cyclopropylmethyl)-N,N-dimethylaniline |
| PubChem CID | 90792914 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 2-(cyclopropylmethyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1CC1CC1 |
| InChI | InChI=1S/C12H17N/c1-13(2)12-6-4-3-5-11(12)9-10-7-8-10/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | RDLKXSYTUVGKRT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(cyclopropylmethyl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopropylmethyl)-N,N-dimethylaniline?
The IUPAC name of 2-(cyclopropylmethyl)-N,N-dimethylaniline (CID 90792914) is 2-(cyclopropylmethyl)-N,N-dimethylaniline.
What is the SMILES notation for 2-(cyclopropylmethyl)-N,N-dimethylaniline?
The canonical SMILES for 2-(cyclopropylmethyl)-N,N-dimethylaniline is CN(C)c1ccccc1CC1CC1.
What is the InChIKey of 2-(cyclopropylmethyl)-N,N-dimethylaniline?
The InChIKey is RDLKXSYTUVGKRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-13(2)12-6-4-3-5-11(12)9-10-7-8-10/h3-6,10H,7-9H2,1-2H3.
What are the key properties of 2-(cyclopropylmethyl)-N,N-dimethylaniline?
2-(cyclopropylmethyl)-N,N-dimethylaniline has a molecular weight of 175.27 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopropylmethyl)-N,N-dimethylaniline is sourced from PubChem (CID 90792914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).