C15H25N — CID 69464807
2-heptyl-N,N-dimethylaniline (PubChem CID 69464807) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 2-heptyl-N,N-dimethylaniline.
| Compound Name | 2-heptyl-N,N-dimethylaniline |
|---|---|
| PubChem CID | 69464807 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 2-heptyl-N,N-dimethylaniline |
| SMILES | CCCCCCCc1ccccc1N(C)C |
| InChI | InChI=1S/C15H25N/c1-4-5-6-7-8-11-14-12-9-10-13-15(14)16(2)3/h9-10,12-13H,4-8,11H2,1-3H3 |
| InChIKey | YIQHNPLNUCWOJA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|