C20H36BrN — CID 175216326
2-dodecyl-N,N-dimethylaniline;hydrobromide (PubChem CID 175216326) has the molecular formula C20H36BrN and a molecular weight of 370.42 g/mol. Its IUPAC name is 2-dodecyl-N,N-dimethylaniline;hydrobromide.
| Compound Name | 2-dodecyl-N,N-dimethylaniline;hydrobromide |
|---|---|
| PubChem CID | 175216326 |
| Molecular Formula | C20H36BrN |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 2-dodecyl-N,N-dimethylaniline;hydrobromide |
| SMILES | Br.CCCCCCCCCCCCc1ccccc1N(C)C |
| InChI | InChI=1S/C20H35N.BrH/c1-4-5-6-7-8-9-10-11-12-13-16-19-17-14-15-18-20(19)21(2)3;/h14-15,17-18H,4-13,16H2,1-3H3;1H |
| InChIKey | HMIQQRCHYJJZHT-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|