C25H46ClN — CID 174968496
N,N-diethyl-2-pentadecylaniline;hydrochloride (PubChem CID 174968496) has the molecular formula C25H46ClN and a molecular weight of 396.10 g/mol. Its IUPAC name is N,N-diethyl-2-pentadecylaniline;hydrochloride.
| Compound Name | N,N-diethyl-2-pentadecylaniline;hydrochloride |
|---|---|
| PubChem CID | 174968496 |
| Molecular Formula | C25H46ClN |
| Molecular Weight | 396.10 g/mol |
| Exact Mass | 395.33 |
| IUPAC Name | N,N-diethyl-2-pentadecylaniline;hydrochloride |
| SMILES | CCCCCCCCCCCCCCCc1ccccc1N(CC)CC.Cl |
| InChI | InChI=1S/C25H45N.ClH/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-21-24-22-19-20-23-25(24)26(5-2)6-3;/h19-20,22-23H,4-18,21H2,1-3H3;1H |
| InChIKey | IRAFDODDTWRIEG-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.10 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|