C18H32BrN — CID 175207974
N,N-diethyl-2-octylaniline;hydrobromide (PubChem CID 175207974) has the molecular formula C18H32BrN and a molecular weight of 342.37 g/mol. Its IUPAC name is N,N-diethyl-2-octylaniline;hydrobromide.
| Compound Name | N,N-diethyl-2-octylaniline;hydrobromide |
|---|---|
| PubChem CID | 175207974 |
| Molecular Formula | C18H32BrN |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N,N-diethyl-2-octylaniline;hydrobromide |
| SMILES | Br.CCCCCCCCc1ccccc1N(CC)CC |
| InChI | InChI=1S/C18H31N.BrH/c1-4-7-8-9-10-11-14-17-15-12-13-16-18(17)19(5-2)6-3;/h12-13,15-16H,4-11,14H2,1-3H3;1H |
| InChIKey | XROARNSEAARQGI-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|