C15H19N — CID 163487751
2-(cyclohexa-2,4-dien-1-ylmethyl)-N,N-dimethylaniline (PubChem CID 163487751) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-(cyclohexa-2,4-dien-1-ylmethyl)-N,N-dimethylaniline.
| Compound Name | 2-(cyclohexa-2,4-dien-1-ylmethyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 163487751 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-(cyclohexa-2,4-dien-1-ylmethyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1CC1C=CC=CC1 |
| InChI | InChI=1S/C15H19N/c1-16(2)15-11-7-6-10-14(15)12-13-8-4-3-5-9-13/h3-8,10-11,13H,9,12H2,1-2H3 |
| InChIKey | CJZBZACLRULSMY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |