C14H22N2 — CID 162293522
1-[2-(cyclopentylmethyl)phenyl]-1,2-dimethylhydrazine (PubChem CID 162293522) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-[2-(cyclopentylmethyl)phenyl]-1,2-dimethylhydrazine.
| Compound Name | 1-[2-(cyclopentylmethyl)phenyl]-1,2-dimethylhydrazine |
|---|---|
| PubChem CID | 162293522 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1-[2-(cyclopentylmethyl)phenyl]-1,2-dimethylhydrazine |
| SMILES | CNN(C)c1ccccc1CC1CCCC1 |
| InChI | InChI=1S/C14H22N2/c1-15-16(2)14-10-6-5-9-13(14)11-12-7-3-4-8-12/h5-6,9-10,12,15H,3-4,7-8,11H2,1-2H3 |
| InChIKey | NFSZXUXJVHFROF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|