C9H12N2O — CID 91088009
N,N-dimethyl-2-(nitrosomethyl)aniline (PubChem CID 91088009) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is N,N-dimethyl-2-(nitrosomethyl)aniline.
| Compound Name | N,N-dimethyl-2-(nitrosomethyl)aniline |
|---|---|
| PubChem CID | 91088009 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | N,N-dimethyl-2-(nitrosomethyl)aniline |
| SMILES | CN(C)c1ccccc1CN=O |
| InChI | InChI=1S/C9H12N2O/c1-11(2)9-6-4-3-5-8(9)7-10-12/h3-6H,7H2,1-2H3 |
| InChIKey | LQUPPOFGWWIHFA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |