C13H22InN — CID 88506247
2-(diethylindiganylmethyl)-N,N-dimethylaniline (PubChem CID 88506247) has the molecular formula C13H22InN and a molecular weight of 307.14 g/mol. Its IUPAC name is 2-(diethylindiganylmethyl)-N,N-dimethylaniline.
| Compound Name | 2-(diethylindiganylmethyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 88506247 |
| Molecular Formula | C13H22InN |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-(diethylindiganylmethyl)-N,N-dimethylaniline |
| SMILES | CC[In](CC)Cc1ccccc1N(C)C |
| InChI | InChI=1S/C9H12N.2C2H5.In/c1-8-6-4-5-7-9(8)10(2)3;2*1-2;/h4-7H,1H2,2-3H3;2*1H2,2H3; |
| InChIKey | KJVGSVLIEXVARE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |