C17H30AlN — CID 87741099
2-(dibutylalumanylmethyl)-N,N-dimethylaniline (PubChem CID 87741099) has the molecular formula C17H30AlN and a molecular weight of 275.42 g/mol. Its IUPAC name is 2-(dibutylalumanylmethyl)-N,N-dimethylaniline.
| Compound Name | 2-(dibutylalumanylmethyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 87741099 |
| Molecular Formula | C17H30AlN |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 2-(dibutylalumanylmethyl)-N,N-dimethylaniline |
| SMILES | CCCC[Al](CCCC)Cc1ccccc1N(C)C |
| InChI | InChI=1S/C9H12N.2C4H9.Al/c1-8-6-4-5-7-9(8)10(2)3;2*1-3-4-2;/h4-7H,1H2,2-3H3;2*1,3-4H2,2H3; |
| InChIKey | LWBHGJOVIQJHQT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |