C26H37AuClFNO3PS — CID 178116965
chlorogold;dicyclohexyl-[2-(dimethylamino)phenyl]phosphanium;fluorosulfonyloxybenzene (PubChem CID 178116965) has the molecular formula C26H37AuClFNO3PS and a molecular weight of 726.04 g/mol. Its IUPAC name is chlorogold;dicyclohexyl-[2-(dimethylamino)phenyl]phosphanium;fluorosulfonyloxybenzene.
| Compound Name | chlorogold;dicyclohexyl-[2-(dimethylamino)phenyl]phosphanium;fluorosulfonyloxybenzene |
|---|---|
| PubChem CID | 178116965 |
| Molecular Formula | C26H37AuClFNO3PS |
| Molecular Weight | 726.04 g/mol |
| Exact Mass | 725.16 |
| IUPAC Name | chlorogold;dicyclohexyl-[2-(dimethylamino)phenyl]phosphanium;fluorosulfonyloxybenzene |
| SMILES | CN(C)c1ccccc1[PH+](C1CCCCC1)C1CCCCC1.Cl[Au].O=S(=O)(F)Oc1cc[c-]cc1 |
| InChI | InChI=1S/C20H32NP.C6H4FO3S.Au.ClH/c1-21(2)19-15-9-10-16-20(19)22(17-11-5-3-6-12-17)18-13-7-4-8-14-18;7-11(8,9)10-6-4-2-1-3-5-6;;/h9-10,15-18H,3-8,11-14H2,1-2H3;2-5H;;1H/q;-1;+1; |
| InChIKey | ZTIXLCLAKXZDNX-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.04 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|