C26H36AuClF2NO2PS — CID 178116893
chlorogold;dicyclohexyl-[2-(dimethylamino)phenyl]phosphanium;1-fluoro-2-fluorosulfinyloxybenzene-6-ide (PubChem CID 178116893) has the molecular formula C26H36AuClF2NO2PS and a molecular weight of 728.04 g/mol. Its IUPAC name is chlorogold;dicyclohexyl-[2-(dimethylamino)phenyl]phosphanium;1-fluoro-2-fluorosulfinyloxybenzene-6-ide.
| Compound Name | chlorogold;dicyclohexyl-[2-(dimethylamino)phenyl]phosphanium;1-fluoro-2-fluorosulfinyloxybenzene-6-ide |
|---|---|
| PubChem CID | 178116893 |
| Molecular Formula | C26H36AuClF2NO2PS |
| Molecular Weight | 728.04 g/mol |
| Exact Mass | 727.15 |
| IUPAC Name | chlorogold;dicyclohexyl-[2-(dimethylamino)phenyl]phosphanium;1-fluoro-2-fluorosulfinyloxybenzene-6-ide |
| SMILES | CN(C)c1ccccc1[PH+](C1CCCCC1)C1CCCCC1.Cl[Au].O=S(F)Oc1ccc[c-]c1F |
| InChI | InChI=1S/C20H32NP.C6H3F2O2S.Au.ClH/c1-21(2)19-15-9-10-16-20(19)22(17-11-5-3-6-12-17)18-13-7-4-8-14-18;7-5-3-1-2-4-6(5)10-11(8)9;;/h9-10,15-18H,3-8,11-14H2,1-2H3;1-2,4H;;1H/q;-1;+1; |
| InChIKey | QVTBFXPHBLZKNH-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.04 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|