C20H24AuClN3O- — CID 172516512
chlorogold;4-[2-(2,4,6-trimethylphenyl)-3H-imidazo[1,5-a]pyridin-3-id-5-yl]morpholine (PubChem CID 172516512) has the molecular formula C20H24AuClN3O- and a molecular weight of 554.85 g/mol. Its IUPAC name is chlorogold;4-[2-(2,4,6-trimethylphenyl)-3H-imidazo[1,5-a]pyridin-3-id-5-yl]morpholine.
| Compound Name | chlorogold;4-[2-(2,4,6-trimethylphenyl)-3H-imidazo[1,5-a]pyridin-3-id-5-yl]morpholine |
|---|---|
| PubChem CID | 172516512 |
| Molecular Formula | C20H24AuClN3O- |
| Molecular Weight | 554.85 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | chlorogold;4-[2-(2,4,6-trimethylphenyl)-3H-imidazo[1,5-a]pyridin-3-id-5-yl]morpholine |
| SMILES | Cc1cc(C)c(N2C=C3C=CC=C(N4CCOCC4)N3[CH-]2)c(C)c1.Cl[Au] |
| InChI | InChI=1S/C20H24N3O.Au.ClH/c1-15-11-16(2)20(17(3)12-15)22-13-18-5-4-6-19(23(18)14-22)21-7-9-24-10-8-21;;/h4-6,11-14H,7-10H2,1-3H3;;1H/q-1;+1;/p-1 |
| InChIKey | GFWJSNYABLGWLT-UHFFFAOYSA-M |
| XLogP | 4.12 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|